C19H15F3O3 — CID 58406737
methyl 2,2-dimethyl-4-(2,4,5-trifluorophenyl)chromene-6-carboxylate (PubChem CID 58406737) has the molecular formula C19H15F3O3 and a molecular weight of 348.32 g/mol. Its IUPAC name is methyl 2,2-dimethyl-4-(2,4,5-trifluorophenyl)chromene-6-carboxylate.
| Compound Name | methyl 2,2-dimethyl-4-(2,4,5-trifluorophenyl)chromene-6-carboxylate |
|---|---|
| PubChem CID | 58406737 |
| Molecular Formula | C19H15F3O3 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | methyl 2,2-dimethyl-4-(2,4,5-trifluorophenyl)chromene-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(c1cc(F)c(F)cc1F)=CC(C)(C)O2 |
| InChI | InChI=1S/C19H15F3O3/c1-19(2)9-13(11-7-15(21)16(22)8-14(11)20)12-6-10(18(23)24-3)4-5-17(12)25-19/h4-9H,1-3H3 |
| InChIKey | XIQOHPKGDTWEJI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|