C14H8F4O2 — CID 151858765
methyl 3-fluoro-4-(3,4,5-trifluorophenyl)benzoate (PubChem CID 151858765) has the molecular formula C14H8F4O2 and a molecular weight of 284.21 g/mol. Its IUPAC name is methyl 3-fluoro-4-(3,4,5-trifluorophenyl)benzoate.
| Compound Name | methyl 3-fluoro-4-(3,4,5-trifluorophenyl)benzoate |
|---|---|
| PubChem CID | 151858765 |
| Molecular Formula | C14H8F4O2 |
| Molecular Weight | 284.21 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | methyl 3-fluoro-4-(3,4,5-trifluorophenyl)benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(F)c(F)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C14H8F4O2/c1-20-14(19)7-2-3-9(10(15)4-7)8-5-11(16)13(18)12(17)6-8/h2-6H,1H3 |
| InChIKey | SKGKCTAVJSQHGS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.21 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|