C17H12F2O3 — CID 58406748
methyl 4-(3,5-difluorophenyl)-2H-chromene-6-carboxylate (PubChem CID 58406748) has the molecular formula C17H12F2O3 and a molecular weight of 302.28 g/mol. Its IUPAC name is methyl 4-(3,5-difluorophenyl)-2H-chromene-6-carboxylate.
| Compound Name | methyl 4-(3,5-difluorophenyl)-2H-chromene-6-carboxylate |
|---|---|
| PubChem CID | 58406748 |
| Molecular Formula | C17H12F2O3 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | methyl 4-(3,5-difluorophenyl)-2H-chromene-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(c1cc(F)cc(F)c1)=CCO2 |
| InChI | InChI=1S/C17H12F2O3/c1-21-17(20)10-2-3-16-15(8-10)14(4-5-22-16)11-6-12(18)9-13(19)7-11/h2-4,6-9H,5H2,1H3 |
| InChIKey | XFMCHHZJKJTZTA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |