methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate

C18H15ClO4 — CID 70895512

IUPACmethyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate
SMILESCOC(=O)c1ccc2c(c1)C(c1c(Cl)cccc1OC)=CCO2
InChIInChI=1S/C18H15ClO4/c1-21-16-5-3-4-14(19)17(16)12-8-9-23-15-7-6-11(10-13(12)15)18(20)22-2/h3-8,10H,9H2,1-2H3
InChIKeyXDEGDAORLKQSTI-UHFFFAOYSA-N
MW330.77 g/mol
LogP3.96
Rot. Bonds3

About methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate

methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate (PubChem CID 70895512) has the molecular formula C18H15ClO4 and a molecular weight of 330.77 g/mol. Its IUPAC name is methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate.

Molecular Properties

Compound Namemethyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate
PubChem CID70895512
Molecular FormulaC18H15ClO4
Molecular Weight330.77 g/mol
Exact Mass330.07
IUPAC Namemethyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate
SMILESCOC(=O)c1ccc2c(c1)C(c1c(Cl)cccc1OC)=CCO2
InChIInChI=1S/C18H15ClO4/c1-21-16-5-3-4-14(19)17(16)12-8-9-23-15-7-6-11(10-13(12)15)18(20)22-2/h3-8,10H,9H2,1-2H3
InChIKeyXDEGDAORLKQSTI-UHFFFAOYSA-N
XLogP3.96
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.77
LogP ≤ 53.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate?
The IUPAC name of methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate (CID 70895512) is methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate.
What is the SMILES notation for methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate?
The canonical SMILES for methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate is COC(=O)c1ccc2c(c1)C(c1c(Cl)cccc1OC)=CCO2.
What is the InChIKey of methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate?
The InChIKey is XDEGDAORLKQSTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15ClO4/c1-21-16-5-3-4-14(19)17(16)12-8-9-23-15-7-6-11(10-13(12)15)18(20)22-2/h3-8,10H,9H2,1-2H3.
What are the key properties of methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate?
methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate has a molecular weight of 330.77 g/mol, XLogP of 3.96, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-chloro-6-methoxyphenyl)-2H-chromene-6-carboxylate is sourced from PubChem (CID 70895512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).