C22H20N2O4 — CID 177445154
methyl 4-[[4-(2,6-dimethoxyphenyl)phenyl]diazenyl]benzoate (PubChem CID 177445154) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl 4-[[4-(2,6-dimethoxyphenyl)phenyl]diazenyl]benzoate.
| Compound Name | methyl 4-[[4-(2,6-dimethoxyphenyl)phenyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 177445154 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | methyl 4-[[4-(2,6-dimethoxyphenyl)phenyl]diazenyl]benzoate |
| SMILES | COC(=O)c1ccc(/N=N/c2ccc(-c3c(OC)cccc3OC)cc2)cc1 |
| InChI | InChI=1S/C22H20N2O4/c1-26-19-5-4-6-20(27-2)21(19)15-7-11-17(12-8-15)23-24-18-13-9-16(10-14-18)22(25)28-3/h4-14H,1-3H3/b24-23+ |
| InChIKey | BFRWDPMINFGWOU-WCWDXBQESA-N |
| XLogP | 5.57 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|