C15H11Cl3O4 — CID 131879057
methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate (PubChem CID 131879057) has the molecular formula C15H11Cl3O4 and a molecular weight of 361.61 g/mol. Its IUPAC name is methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate.
| Compound Name | methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate |
|---|---|
| PubChem CID | 131879057 |
| Molecular Formula | C15H11Cl3O4 |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 359.97 |
| IUPAC Name | methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate |
| SMILES | COC(=O)c1ccc(Oc2c(Cl)cc(Cl)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C15H11Cl3O4/c1-20-13-5-8(15(19)21-2)3-4-12(13)22-14-10(17)6-9(16)7-11(14)18/h3-7H,1-2H3 |
| InChIKey | SOZQAELRVBSQCO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |