methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate

C15H11Cl3O4 — CID 131879057

IUPACmethyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate
SMILESCOC(=O)c1ccc(Oc2c(Cl)cc(Cl)cc2Cl)c(OC)c1
InChIInChI=1S/C15H11Cl3O4/c1-20-13-5-8(15(19)21-2)3-4-12(13)22-14-10(17)6-9(16)7-11(14)18/h3-7H,1-2H3
InChIKeySOZQAELRVBSQCO-UHFFFAOYSA-N
MW361.61 g/mol
LogP5.23
Rot. Bonds4

About methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate

methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate (PubChem CID 131879057) has the molecular formula C15H11Cl3O4 and a molecular weight of 361.61 g/mol. Its IUPAC name is methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate.

Molecular Properties

Compound Namemethyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate
PubChem CID131879057
Molecular FormulaC15H11Cl3O4
Molecular Weight361.61 g/mol
Exact Mass359.97
IUPAC Namemethyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate
SMILESCOC(=O)c1ccc(Oc2c(Cl)cc(Cl)cc2Cl)c(OC)c1
InChIInChI=1S/C15H11Cl3O4/c1-20-13-5-8(15(19)21-2)3-4-12(13)22-14-10(17)6-9(16)7-11(14)18/h3-7H,1-2H3
InChIKeySOZQAELRVBSQCO-UHFFFAOYSA-N
XLogP5.23
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500361.61
LogP ≤ 55.23
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate?
The IUPAC name of methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate (CID 131879057) is methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate.
What is the SMILES notation for methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate?
The canonical SMILES for methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate is COC(=O)c1ccc(Oc2c(Cl)cc(Cl)cc2Cl)c(OC)c1.
What is the InChIKey of methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate?
The InChIKey is SOZQAELRVBSQCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl3O4/c1-20-13-5-8(15(19)21-2)3-4-12(13)22-14-10(17)6-9(16)7-11(14)18/h3-7H,1-2H3.
What are the key properties of methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate?
methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate has a molecular weight of 361.61 g/mol, XLogP of 5.23, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methoxy-4-(2,4,6-trichlorophenoxy)benzoate is sourced from PubChem (CID 131879057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).