C13H10BCl3O4 — CID 156686350
[3,5-dichloro-4-(4-chloro-2-methoxyphenoxy)phenyl]boronic acid (PubChem CID 156686350) has the molecular formula C13H10BCl3O4 and a molecular weight of 347.39 g/mol. Its IUPAC name is [3,5-dichloro-4-(4-chloro-2-methoxyphenoxy)phenyl]boronic acid.
| Compound Name | [3,5-dichloro-4-(4-chloro-2-methoxyphenoxy)phenyl]boronic acid |
|---|---|
| PubChem CID | 156686350 |
| Molecular Formula | C13H10BCl3O4 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 345.97 |
| IUPAC Name | [3,5-dichloro-4-(4-chloro-2-methoxyphenoxy)phenyl]boronic acid |
| SMILES | COc1cc(Cl)ccc1Oc1c(Cl)cc(B(O)O)cc1Cl |
| InChI | InChI=1S/C13H10BCl3O4/c1-20-12-6-8(15)2-3-11(12)21-13-9(16)4-7(14(18)19)5-10(13)17/h2-6,18-19H,1H3 |
| InChIKey | HTGVHABDEUTQIN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|