C17H15ClO6 — CID 167057664
methyl 4-(2-chloro-4-formylphenoxy)-3,5-dimethoxybenzoate (PubChem CID 167057664) has the molecular formula C17H15ClO6 and a molecular weight of 350.75 g/mol. Its IUPAC name is methyl 4-(2-chloro-4-formylphenoxy)-3,5-dimethoxybenzoate.
| Compound Name | methyl 4-(2-chloro-4-formylphenoxy)-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 167057664 |
| Molecular Formula | C17H15ClO6 |
| Molecular Weight | 350.75 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | methyl 4-(2-chloro-4-formylphenoxy)-3,5-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(Oc2ccc(C=O)cc2Cl)c(OC)c1 |
| InChI | InChI=1S/C17H15ClO6/c1-21-14-7-11(17(20)23-3)8-15(22-2)16(14)24-13-5-4-10(9-19)6-12(13)18/h4-9H,1-3H3 |
| InChIKey | GMZINYLRIVOJAZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.75 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|