C15H11ClI2O4 — CID 15462368
methyl 4-(2-chloro-4-methoxyphenoxy)-3,5-diiodobenzoate (PubChem CID 15462368) has the molecular formula C15H11ClI2O4 and a molecular weight of 544.51 g/mol. Its IUPAC name is methyl 4-(2-chloro-4-methoxyphenoxy)-3,5-diiodobenzoate.
| Compound Name | methyl 4-(2-chloro-4-methoxyphenoxy)-3,5-diiodobenzoate |
|---|---|
| PubChem CID | 15462368 |
| Molecular Formula | C15H11ClI2O4 |
| Molecular Weight | 544.51 g/mol |
| Exact Mass | 543.84 |
| IUPAC Name | methyl 4-(2-chloro-4-methoxyphenoxy)-3,5-diiodobenzoate |
| SMILES | COC(=O)c1cc(I)c(Oc2ccc(OC)cc2Cl)c(I)c1 |
| InChI | InChI=1S/C15H11ClI2O4/c1-20-9-3-4-13(10(16)7-9)22-14-11(17)5-8(6-12(14)18)15(19)21-2/h3-7H,1-2H3 |
| InChIKey | ANAFIRQXNNUHQV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|