C30H26I4N2O6 — CID 87669253
1-[4-(3-amino-4-methoxyphenoxy)-3,5-diiodophenyl]ethanone (PubChem CID 87669253) has the molecular formula C30H26I4N2O6 and a molecular weight of 1018.16 g/mol. Its IUPAC name is 1-[4-(3-amino-4-methoxyphenoxy)-3,5-diiodophenyl]ethanone.
| Compound Name | 1-[4-(3-amino-4-methoxyphenoxy)-3,5-diiodophenyl]ethanone |
|---|---|
| PubChem CID | 87669253 |
| Molecular Formula | C30H26I4N2O6 |
| Molecular Weight | 1018.16 g/mol |
| Exact Mass | 1017.80 |
| IUPAC Name | 1-[4-(3-amino-4-methoxyphenoxy)-3,5-diiodophenyl]ethanone |
| SMILES | COc1ccc(Oc2c(I)cc(C(C)=O)cc2I)cc1N.COc1ccc(Oc2c(I)cc(C(C)=O)cc2I)cc1N |
| InChI | InChI=1S/2C15H13I2NO3/c2*1-8(19)9-5-11(16)15(12(17)6-9)21-10-3-4-14(20-2)13(18)7-10/h2*3-7H,18H2,1-2H3 |
| InChIKey | HZWBAESPKCUFCV-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1018.16 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|