C15H13I2NO3 — CID 25064589
1-[4-(2-amino-4-methoxyphenoxy)-3,5-diiodophenyl]ethanone (PubChem CID 25064589) has the molecular formula C15H13I2NO3 and a molecular weight of 509.08 g/mol. Its IUPAC name is 1-[4-(2-amino-4-methoxyphenoxy)-3,5-diiodophenyl]ethanone.
| Compound Name | 1-[4-(2-amino-4-methoxyphenoxy)-3,5-diiodophenyl]ethanone |
|---|---|
| PubChem CID | 25064589 |
| Molecular Formula | C15H13I2NO3 |
| Molecular Weight | 509.08 g/mol |
| Exact Mass | 508.90 |
| IUPAC Name | 1-[4-(2-amino-4-methoxyphenoxy)-3,5-diiodophenyl]ethanone |
| SMILES | COc1ccc(Oc2c(I)cc(C(C)=O)cc2I)c(N)c1 |
| InChI | InChI=1S/C15H13I2NO3/c1-8(19)9-5-11(16)15(12(17)6-9)21-14-4-3-10(20-2)7-13(14)18/h3-7H,18H2,1-2H3 |
| InChIKey | MHDVYXXSGAVQBB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.08 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|