C17H14Cl2O5 — CID 8840295
methyl 4-[2-(2,6-dichlorophenyl)acetyl]oxy-3-methoxybenzoate (PubChem CID 8840295) has the molecular formula C17H14Cl2O5 and a molecular weight of 369.20 g/mol. Its IUPAC name is methyl 4-[2-(2,6-dichlorophenyl)acetyl]oxy-3-methoxybenzoate.
| Compound Name | methyl 4-[2-(2,6-dichlorophenyl)acetyl]oxy-3-methoxybenzoate |
|---|---|
| PubChem CID | 8840295 |
| Molecular Formula | C17H14Cl2O5 |
| Molecular Weight | 369.20 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | methyl 4-[2-(2,6-dichlorophenyl)acetyl]oxy-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(OC(=O)Cc2c(Cl)cccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C17H14Cl2O5/c1-22-15-8-10(17(21)23-2)6-7-14(15)24-16(20)9-11-12(18)4-3-5-13(11)19/h3-8H,9H2,1-2H3 |
| InChIKey | LJXMYAZUCUPBOH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.20 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|