C18H18N2O6 — CID 17175462
methyl 3-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]benzoate (PubChem CID 17175462) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is methyl 3-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]benzoate.
| Compound Name | methyl 3-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 17175462 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | methyl 3-[[(3,4-dimethoxybenzoyl)amino]carbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NNC(=O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C18H18N2O6/c1-24-14-8-7-12(10-15(14)25-2)17(22)20-19-16(21)11-5-4-6-13(9-11)18(23)26-3/h4-10H,1-3H3,(H,19,21)(H,20,22) |
| InChIKey | SBUKHWRSJKLRJF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|