C18H17N3O5 — CID 17175396
methyl 3-[[(4-acetamidobenzoyl)amino]carbamoyl]benzoate (PubChem CID 17175396) has the molecular formula C18H17N3O5 and a molecular weight of 355.35 g/mol. Its IUPAC name is methyl 3-[[(4-acetamidobenzoyl)amino]carbamoyl]benzoate.
| Compound Name | methyl 3-[[(4-acetamidobenzoyl)amino]carbamoyl]benzoate |
|---|---|
| PubChem CID | 17175396 |
| Molecular Formula | C18H17N3O5 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | methyl 3-[[(4-acetamidobenzoyl)amino]carbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NNC(=O)c2ccc(NC(C)=O)cc2)c1 |
| InChI | InChI=1S/C18H17N3O5/c1-11(22)19-15-8-6-12(7-9-15)16(23)20-21-17(24)13-4-3-5-14(10-13)18(25)26-2/h3-10H,1-2H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | QHKKKBFJPDSJKM-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|