C21H20N4O5S — CID 17175803
methyl 3-[[[4-(cyclopropanecarbonylamino)benzoyl]amino]carbamothioylcarbamoyl]benzoate (PubChem CID 17175803) has the molecular formula C21H20N4O5S and a molecular weight of 440.48 g/mol. Its IUPAC name is methyl 3-[[[4-(cyclopropanecarbonylamino)benzoyl]amino]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 3-[[[4-(cyclopropanecarbonylamino)benzoyl]amino]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17175803 |
| Molecular Formula | C21H20N4O5S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | methyl 3-[[[4-(cyclopropanecarbonylamino)benzoyl]amino]carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)NC(=S)NNC(=O)c2ccc(NC(=O)C3CC3)cc2)c1 |
| InChI | InChI=1S/C21H20N4O5S/c1-30-20(29)15-4-2-3-14(11-15)18(27)23-21(31)25-24-19(28)13-7-9-16(10-8-13)22-17(26)12-5-6-12/h2-4,7-12H,5-6H2,1H3,(H,22,26)(H,24,28)(H2,23,25,27,31) |
| InChIKey | VQCAOMFTZMQCOM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|