C24H26N4O5S — CID 17178727
methyl 4-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioylcarbamoyl]benzoate (PubChem CID 17178727) has the molecular formula C24H26N4O5S and a molecular weight of 482.56 g/mol. Its IUPAC name is methyl 4-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioylcarbamoyl]benzoate.
| Compound Name | methyl 4-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioylcarbamoyl]benzoate |
|---|---|
| PubChem CID | 17178727 |
| Molecular Formula | C24H26N4O5S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | methyl 4-[[[4-(cyclohexanecarbonylamino)benzoyl]amino]carbamothioylcarbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)NC(=S)NNC(=O)c2ccc(NC(=O)C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H26N4O5S/c1-33-23(32)18-9-7-16(8-10-18)21(30)26-24(34)28-27-22(31)17-11-13-19(14-12-17)25-20(29)15-5-3-2-4-6-15/h7-15H,2-6H2,1H3,(H,25,29)(H,27,31)(H2,26,28,30,34) |
| InChIKey | COEXOLIYFWHTPW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|