C20H19N5O4 — CID 31890706
3,4-dimethoxy-N'-[3-(pyrimidin-2-ylamino)benzoyl]benzohydrazide (PubChem CID 31890706) has the molecular formula C20H19N5O4 and a molecular weight of 393.40 g/mol. Its IUPAC name is 3,4-dimethoxy-N'-[3-(pyrimidin-2-ylamino)benzoyl]benzohydrazide.
| Compound Name | 3,4-dimethoxy-N'-[3-(pyrimidin-2-ylamino)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 31890706 |
| Molecular Formula | C20H19N5O4 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3,4-dimethoxy-N'-[3-(pyrimidin-2-ylamino)benzoyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)c2cccc(Nc3ncccn3)c2)cc1OC |
| InChI | InChI=1S/C20H19N5O4/c1-28-16-8-7-14(12-17(16)29-2)19(27)25-24-18(26)13-5-3-6-15(11-13)23-20-21-9-4-10-22-20/h3-12H,1-2H3,(H,24,26)(H,25,27)(H,21,22,23) |
| InChIKey | WKLRJXHOHFZLCH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|