C19H19NO7 — CID 1355426
dimethyl 5-[(3,4-dimethoxybenzoyl)amino]benzene-1,3-dicarboxylate (PubChem CID 1355426) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is dimethyl 5-[(3,4-dimethoxybenzoyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(3,4-dimethoxybenzoyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 1355426 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | dimethyl 5-[(3,4-dimethoxybenzoyl)amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccc(OC)c(OC)c2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H19NO7/c1-24-15-6-5-11(10-16(15)25-2)17(21)20-14-8-12(18(22)26-3)7-13(9-14)19(23)27-4/h5-10H,1-4H3,(H,20,21) |
| InChIKey | FWAXLEDHMBAFGM-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |