C18H16O3 — CID 58406511
methyl 5-phenyl-2,3-dihydro-1-benzoxepine-7-carboxylate (PubChem CID 58406511) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 5-phenyl-2,3-dihydro-1-benzoxepine-7-carboxylate.
| Compound Name | methyl 5-phenyl-2,3-dihydro-1-benzoxepine-7-carboxylate |
|---|---|
| PubChem CID | 58406511 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl 5-phenyl-2,3-dihydro-1-benzoxepine-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(c1ccccc1)=CCCO2 |
| InChI | InChI=1S/C18H16O3/c1-20-18(19)14-9-10-17-16(12-14)15(8-5-11-21-17)13-6-3-2-4-7-13/h2-4,6-10,12H,5,11H2,1H3 |
| InChIKey | ISAIOZKGJJCEKH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |