C18H15NO4 — CID 58407020
methyl 8-(4-nitrophenyl)-5,6-dihydronaphthalene-2-carboxylate (PubChem CID 58407020) has the molecular formula C18H15NO4 and a molecular weight of 309.32 g/mol. Its IUPAC name is methyl 8-(4-nitrophenyl)-5,6-dihydronaphthalene-2-carboxylate.
| Compound Name | methyl 8-(4-nitrophenyl)-5,6-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58407020 |
| Molecular Formula | C18H15NO4 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 8-(4-nitrophenyl)-5,6-dihydronaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(c1ccc([N+](=O)[O-])cc1)=CCC2 |
| InChI | InChI=1S/C18H15NO4/c1-23-18(20)14-6-5-12-3-2-4-16(17(12)11-14)13-7-9-15(10-8-13)19(21)22/h4-11H,2-3H2,1H3 |
| InChIKey | SMEFUKDZTGHBJG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|