C17H20O3 — CID 58406691
methyl 8-(oxan-4-yl)-5,6-dihydronaphthalene-2-carboxylate (PubChem CID 58406691) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is methyl 8-(oxan-4-yl)-5,6-dihydronaphthalene-2-carboxylate.
| Compound Name | methyl 8-(oxan-4-yl)-5,6-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58406691 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | methyl 8-(oxan-4-yl)-5,6-dihydronaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(C1CCOCC1)=CCC2 |
| InChI | InChI=1S/C17H20O3/c1-19-17(18)14-6-5-12-3-2-4-15(16(12)11-14)13-7-9-20-10-8-13/h4-6,11,13H,2-3,7-10H2,1H3 |
| InChIKey | SRBZKURHWDOPCC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |