C16H14N2O2 — CID 58406598
methyl 8-pyrazin-2-yl-5,6-dihydronaphthalene-2-carboxylate (PubChem CID 58406598) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is methyl 8-pyrazin-2-yl-5,6-dihydronaphthalene-2-carboxylate.
| Compound Name | methyl 8-pyrazin-2-yl-5,6-dihydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58406598 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | methyl 8-pyrazin-2-yl-5,6-dihydronaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(c1cnccn1)=CCC2 |
| InChI | InChI=1S/C16H14N2O2/c1-20-16(19)12-6-5-11-3-2-4-13(14(11)9-12)15-10-17-7-8-18-15/h4-10H,2-3H2,1H3 |
| InChIKey | MBFUNLMHQAQIIF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |