C21H18F2N4O2 — CID 7593337
2,6-difluoro-N-[4-(6-morpholin-4-ylpyridazin-3-yl)phenyl]benzamide (PubChem CID 7593337) has the molecular formula C21H18F2N4O2 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2,6-difluoro-N-[4-(6-morpholin-4-ylpyridazin-3-yl)phenyl]benzamide.
| Compound Name | 2,6-difluoro-N-[4-(6-morpholin-4-ylpyridazin-3-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 7593337 |
| Molecular Formula | C21H18F2N4O2 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2,6-difluoro-N-[4-(6-morpholin-4-ylpyridazin-3-yl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(-c2ccc(N3CCOCC3)nn2)cc1)c1c(F)cccc1F |
| InChI | InChI=1S/C21H18F2N4O2/c22-16-2-1-3-17(23)20(16)21(28)24-15-6-4-14(5-7-15)18-8-9-19(26-25-18)27-10-12-29-13-11-27/h1-9H,10-13H2,(H,24,28) |
| InChIKey | NGDGZDCTXBXIAD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |