C21H19F2N5O2 — CID 43992816
1-(2,4-difluorophenyl)-3-[4-(6-morpholin-4-ylpyridazin-3-yl)phenyl]urea (PubChem CID 43992816) has the molecular formula C21H19F2N5O2 and a molecular weight of 411.41 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[4-(6-morpholin-4-ylpyridazin-3-yl)phenyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[4-(6-morpholin-4-ylpyridazin-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 43992816 |
| Molecular Formula | C21H19F2N5O2 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[4-(6-morpholin-4-ylpyridazin-3-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-c2ccc(N3CCOCC3)nn2)cc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C21H19F2N5O2/c22-15-3-6-19(17(23)13-15)25-21(29)24-16-4-1-14(2-5-16)18-7-8-20(27-26-18)28-9-11-30-12-10-28/h1-8,13H,9-12H2,(H2,24,25,29) |
| InChIKey | RJWDBMCFNWIKJG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |