C11H9BrO2 — CID 102650842
(4-bromophenyl)-(2,3-dihydrofuran-5-yl)methanone (PubChem CID 102650842) has the molecular formula C11H9BrO2 and a molecular weight of 253.09 g/mol. Its IUPAC name is (4-bromophenyl)-(2,3-dihydrofuran-5-yl)methanone.
| Compound Name | (4-bromophenyl)-(2,3-dihydrofuran-5-yl)methanone |
|---|---|
| PubChem CID | 102650842 |
| Molecular Formula | C11H9BrO2 |
| Molecular Weight | 253.09 g/mol |
| Exact Mass | 251.98 |
| IUPAC Name | (4-bromophenyl)-(2,3-dihydrofuran-5-yl)methanone |
| SMILES | O=C(C1=CCCO1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H9BrO2/c12-9-5-3-8(4-6-9)11(13)10-2-1-7-14-10/h2-6H,1,7H2 |
| InChIKey | KVRCLTYVGCBKHY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.09 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |