About (2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone
(2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone (PubChem CID 106691362) has the molecular formula C9H7ClO3
and a molecular weight of 198.61 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone.
Analyze (2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone?
The IUPAC name of (2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone (CID 106691362) is (2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone.
What is the SMILES notation for (2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone?
The canonical SMILES for (2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone is O=C(C1=CCCO1)c1ccoc1Cl.
What is the InChIKey of (2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone?
The InChIKey is DMVPIPKBVVRGQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClO3/c10-9-6(3-5-13-9)8(11)7-2-1-4-12-7/h2-3,5H,1,4H2.
What are the key properties of (2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone?
(2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone has a molecular weight of 198.61 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorofuran-3-yl)-(2,3-dihydrofuran-5-yl)methanone is sourced from PubChem (CID 106691362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).