C14H11ClO3 — CID 106691322
(2-chlorofuran-3-yl)-(3,4-dihydro-2H-chromen-8-yl)methanone (PubChem CID 106691322) has the molecular formula C14H11ClO3 and a molecular weight of 262.69 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-(3,4-dihydro-2H-chromen-8-yl)methanone.
| Compound Name | (2-chlorofuran-3-yl)-(3,4-dihydro-2H-chromen-8-yl)methanone |
|---|---|
| PubChem CID | 106691322 |
| Molecular Formula | C14H11ClO3 |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | (2-chlorofuran-3-yl)-(3,4-dihydro-2H-chromen-8-yl)methanone |
| SMILES | O=C(c1ccoc1Cl)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C14H11ClO3/c15-14-11(6-8-18-14)12(16)10-5-1-3-9-4-2-7-17-13(9)10/h1,3,5-6,8H,2,4,7H2 |
| InChIKey | JDHFGYPSPMCSMP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |