C14H13ClO3 — CID 106694050
(2-chlorofuran-3-yl)-(3,4-dihydro-2H-chromen-8-yl)methanol (PubChem CID 106694050) has the molecular formula C14H13ClO3 and a molecular weight of 264.71 g/mol. Its IUPAC name is (2-chlorofuran-3-yl)-(3,4-dihydro-2H-chromen-8-yl)methanol.
| Compound Name | (2-chlorofuran-3-yl)-(3,4-dihydro-2H-chromen-8-yl)methanol |
|---|---|
| PubChem CID | 106694050 |
| Molecular Formula | C14H13ClO3 |
| Molecular Weight | 264.71 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (2-chlorofuran-3-yl)-(3,4-dihydro-2H-chromen-8-yl)methanol |
| SMILES | OC(c1ccoc1Cl)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C14H13ClO3/c15-14-11(6-8-18-14)12(16)10-5-1-3-9-4-2-7-17-13(9)10/h1,3,5-6,8,12,16H,2,4,7H2 |
| InChIKey | DPSJQIYCRULQEW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |