C16H14ClFO2 — CID 114743779
(3-chloro-2-fluorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanol (PubChem CID 114743779) has the molecular formula C16H14ClFO2 and a molecular weight of 292.74 g/mol. Its IUPAC name is (3-chloro-2-fluorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanol.
| Compound Name | (3-chloro-2-fluorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanol |
|---|---|
| PubChem CID | 114743779 |
| Molecular Formula | C16H14ClFO2 |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (3-chloro-2-fluorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanol |
| SMILES | OC(c1cccc(Cl)c1F)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C16H14ClFO2/c17-13-8-2-6-11(14(13)18)15(19)12-7-1-4-10-5-3-9-20-16(10)12/h1-2,4,6-8,15,19H,3,5,9H2 |
| InChIKey | AIJOIGXJQKRTSZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |