C16H15IO2 — CID 115837843
3,4-dihydro-2H-chromen-8-yl-(2-iodophenyl)methanol (PubChem CID 115837843) has the molecular formula C16H15IO2 and a molecular weight of 366.20 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-8-yl-(2-iodophenyl)methanol.
| Compound Name | 3,4-dihydro-2H-chromen-8-yl-(2-iodophenyl)methanol |
|---|---|
| PubChem CID | 115837843 |
| Molecular Formula | C16H15IO2 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 3,4-dihydro-2H-chromen-8-yl-(2-iodophenyl)methanol |
| SMILES | OC(c1ccccc1I)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C16H15IO2/c17-14-9-2-1-7-12(14)15(18)13-8-3-5-11-6-4-10-19-16(11)13/h1-3,5,7-9,15,18H,4,6,10H2 |
| InChIKey | XGHUXRGKYLOILF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|