C15H13IO2 — CID 115838946
2,3-dihydro-1-benzofuran-7-yl-(2-iodophenyl)methanol (PubChem CID 115838946) has the molecular formula C15H13IO2 and a molecular weight of 352.17 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-7-yl-(2-iodophenyl)methanol.
| Compound Name | 2,3-dihydro-1-benzofuran-7-yl-(2-iodophenyl)methanol |
|---|---|
| PubChem CID | 115838946 |
| Molecular Formula | C15H13IO2 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-7-yl-(2-iodophenyl)methanol |
| SMILES | OC(c1ccccc1I)c1cccc2c1OCC2 |
| InChI | InChI=1S/C15H13IO2/c16-13-7-2-1-5-11(13)14(17)12-6-3-4-10-8-9-18-15(10)12/h1-7,14,17H,8-9H2 |
| InChIKey | SVICKSGPWZRODG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|