C13H12O2S — CID 114743275
2,3-dihydro-1-benzofuran-7-yl(thiophen-3-yl)methanol (PubChem CID 114743275) has the molecular formula C13H12O2S and a molecular weight of 232.30 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-7-yl(thiophen-3-yl)methanol.
| Compound Name | 2,3-dihydro-1-benzofuran-7-yl(thiophen-3-yl)methanol |
|---|---|
| PubChem CID | 114743275 |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-7-yl(thiophen-3-yl)methanol |
| SMILES | OC(c1ccsc1)c1cccc2c1OCC2 |
| InChI | InChI=1S/C13H12O2S/c14-12(10-5-7-16-8-10)11-3-1-2-9-4-6-15-13(9)11/h1-3,5,7-8,12,14H,4,6H2 |
| InChIKey | DMCHUNUDHVEXJI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |