C13H13NOS — CID 114744888
2,3-dihydro-1-benzofuran-7-yl(thiophen-3-yl)methanamine (PubChem CID 114744888) has the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. Its IUPAC name is 2,3-dihydro-1-benzofuran-7-yl(thiophen-3-yl)methanamine.
| Compound Name | 2,3-dihydro-1-benzofuran-7-yl(thiophen-3-yl)methanamine |
|---|---|
| PubChem CID | 114744888 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 2,3-dihydro-1-benzofuran-7-yl(thiophen-3-yl)methanamine |
| SMILES | NC(c1ccsc1)c1cccc2c1OCC2 |
| InChI | InChI=1S/C13H13NOS/c14-12(10-5-7-16-8-10)11-3-1-2-9-4-6-15-13(9)11/h1-3,5,7-8,12H,4,6,14H2 |
| InChIKey | PVBRMBULOVPFAH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |