C16H16BrNO — CID 114744841
(4-bromophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanamine (PubChem CID 114744841) has the molecular formula C16H16BrNO and a molecular weight of 318.21 g/mol. Its IUPAC name is (4-bromophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanamine.
| Compound Name | (4-bromophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanamine |
|---|---|
| PubChem CID | 114744841 |
| Molecular Formula | C16H16BrNO |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (4-bromophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanamine |
| SMILES | NC(c1ccc(Br)cc1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C16H16BrNO/c17-13-8-6-11(7-9-13)15(18)14-5-1-3-12-4-2-10-19-16(12)14/h1,3,5-9,15H,2,4,10,18H2 |
| InChIKey | IPPMPRJSQBDJNT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |