C16H15BrClNO — CID 105049185
(4-bromo-3-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanamine (PubChem CID 105049185) has the molecular formula C16H15BrClNO and a molecular weight of 352.66 g/mol. Its IUPAC name is (4-bromo-3-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanamine.
| Compound Name | (4-bromo-3-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanamine |
|---|---|
| PubChem CID | 105049185 |
| Molecular Formula | C16H15BrClNO |
| Molecular Weight | 352.66 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | (4-bromo-3-chlorophenyl)-(3,4-dihydro-2H-chromen-8-yl)methanamine |
| SMILES | NC(c1ccc(Br)c(Cl)c1)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C16H15BrClNO/c17-13-7-6-11(9-14(13)18)15(19)12-5-1-3-10-4-2-8-20-16(10)12/h1,3,5-7,9,15H,2,4,8,19H2 |
| InChIKey | GGOLHOSVQFVNIB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |