C10H13NO2 — CID 102547105
2-amino-1-(2,3-dihydro-1-benzofuran-7-yl)ethanol (PubChem CID 102547105) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-amino-1-(2,3-dihydro-1-benzofuran-7-yl)ethanol.
| Compound Name | 2-amino-1-(2,3-dihydro-1-benzofuran-7-yl)ethanol |
|---|---|
| PubChem CID | 102547105 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-amino-1-(2,3-dihydro-1-benzofuran-7-yl)ethanol |
| SMILES | NCC(O)c1cccc2c1OCC2 |
| InChI | InChI=1S/C10H13NO2/c11-6-9(12)8-3-1-2-7-4-5-13-10(7)8/h1-3,9,12H,4-6,11H2 |
| InChIKey | DAISWCUYYGBEDC-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |