C12H15ClO2 — CID 114744598
4-chloro-1-(2,3-dihydro-1-benzofuran-7-yl)butan-1-ol (PubChem CID 114744598) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 4-chloro-1-(2,3-dihydro-1-benzofuran-7-yl)butan-1-ol.
| Compound Name | 4-chloro-1-(2,3-dihydro-1-benzofuran-7-yl)butan-1-ol |
|---|---|
| PubChem CID | 114744598 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-chloro-1-(2,3-dihydro-1-benzofuran-7-yl)butan-1-ol |
| SMILES | OC(CCCCl)c1cccc2c1OCC2 |
| InChI | InChI=1S/C12H15ClO2/c13-7-2-5-11(14)10-4-1-3-9-6-8-15-12(9)10/h1,3-4,11,14H,2,5-8H2 |
| InChIKey | ZZDOHEWQCCSOAX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|