C10H12O2 — CID 68614116
1-(2,3-dihydro-1-benzofuran-7-yl)ethanol (PubChem CID 68614116) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-7-yl)ethanol.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-7-yl)ethanol |
|---|---|
| PubChem CID | 68614116 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-7-yl)ethanol |
| SMILES | CC(O)c1cccc2c1OCC2 |
| InChI | InChI=1S/C10H12O2/c1-7(11)9-4-2-3-8-5-6-12-10(8)9/h2-4,7,11H,5-6H2,1H3 |
| InChIKey | PVFKLQKJOVGDSX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |