C16H24O2 — CID 114200584
1-(3,4-dihydro-2H-chromen-8-yl)-2,4-dimethylpentan-1-ol (PubChem CID 114200584) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-8-yl)-2,4-dimethylpentan-1-ol.
| Compound Name | 1-(3,4-dihydro-2H-chromen-8-yl)-2,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 114200584 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-8-yl)-2,4-dimethylpentan-1-ol |
| SMILES | CC(C)CC(C)C(O)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C16H24O2/c1-11(2)10-12(3)15(17)14-8-4-6-13-7-5-9-18-16(13)14/h4,6,8,11-12,15,17H,5,7,9-10H2,1-3H3 |
| InChIKey | FDKMNASNWLQCGB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |