C13H18O — CID 160635539
8-(2-methylpropyl)-3,4-dihydro-2H-chromene (PubChem CID 160635539) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 8-(2-methylpropyl)-3,4-dihydro-2H-chromene.
| Compound Name | 8-(2-methylpropyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 160635539 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 8-(2-methylpropyl)-3,4-dihydro-2H-chromene |
| SMILES | CC(C)Cc1cccc2c1OCCC2 |
| InChI | InChI=1S/C13H18O/c1-10(2)9-12-6-3-5-11-7-4-8-14-13(11)12/h3,5-6,10H,4,7-9H2,1-2H3 |
| InChIKey | LBCARUOAQURKCE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |