C13H17BrO — CID 114747076
8-(3-bromo-2-methylpropyl)-3,4-dihydro-2H-chromene (PubChem CID 114747076) has the molecular formula C13H17BrO and a molecular weight of 269.18 g/mol. Its IUPAC name is 8-(3-bromo-2-methylpropyl)-3,4-dihydro-2H-chromene.
| Compound Name | 8-(3-bromo-2-methylpropyl)-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 114747076 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 8-(3-bromo-2-methylpropyl)-3,4-dihydro-2H-chromene |
| SMILES | CC(CBr)Cc1cccc2c1OCCC2 |
| InChI | InChI=1S/C13H17BrO/c1-10(9-14)8-12-5-2-4-11-6-3-7-15-13(11)12/h2,4-5,10H,3,6-9H2,1H3 |
| InChIKey | VIUZZFVBFHROIP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|