C15H20O2 — CID 114746846
1-(3,4-dihydro-2H-chromen-8-yl)hexan-3-one (PubChem CID 114746846) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-8-yl)hexan-3-one.
| Compound Name | 1-(3,4-dihydro-2H-chromen-8-yl)hexan-3-one |
|---|---|
| PubChem CID | 114746846 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-8-yl)hexan-3-one |
| SMILES | CCCC(=O)CCc1cccc2c1OCCC2 |
| InChI | InChI=1S/C15H20O2/c1-2-5-14(16)10-9-13-7-3-6-12-8-4-11-17-15(12)13/h3,6-7H,2,4-5,8-11H2,1H3 |
| InChIKey | LUYKROBMHSCGBI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |