C15H18O4 — CID 114746816
ethyl 5-(2,3-dihydro-1-benzofuran-7-yl)-4-oxopentanoate (PubChem CID 114746816) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is ethyl 5-(2,3-dihydro-1-benzofuran-7-yl)-4-oxopentanoate.
| Compound Name | ethyl 5-(2,3-dihydro-1-benzofuran-7-yl)-4-oxopentanoate |
|---|---|
| PubChem CID | 114746816 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | ethyl 5-(2,3-dihydro-1-benzofuran-7-yl)-4-oxopentanoate |
| SMILES | CCOC(=O)CCC(=O)Cc1cccc2c1OCC2 |
| InChI | InChI=1S/C15H18O4/c1-2-18-14(17)7-6-13(16)10-12-5-3-4-11-8-9-19-15(11)12/h3-5H,2,6-10H2,1H3 |
| InChIKey | TZVKYGSCXQSOTE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |