About tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate
tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate (PubChem CID 170016206) has the molecular formula C18H25NO5
and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate |
| PubChem CID | 170016206 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate |
| SMILES | CCOC(=O)CCc1cccc2c1OCN(C(=O)OC(C)(C)C)C2 |
| InChI | InChI=1S/C18H25NO5/c1-5-22-15(20)10-9-13-7-6-8-14-11-19(12-23-16(13)14)17(21)24-18(2,3)4/h6-8H,5,9-12H2,1-4H3 |
| InChIKey | PSXXCCKGKBDCOB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate?
The IUPAC name of tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate (CID 170016206) is tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate.
What is the SMILES notation for tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate?
The canonical SMILES for tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate is CCOC(=O)CCc1cccc2c1OCN(C(=O)OC(C)(C)C)C2.
What is the InChIKey of tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate?
The InChIKey is PSXXCCKGKBDCOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25NO5/c1-5-22-15(20)10-9-13-7-6-8-14-11-19(12-23-16(13)14)17(21)24-18(2,3)4/h6-8H,5,9-12H2,1-4H3.
What are the key properties of tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate?
tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate has a molecular weight of 335.40 g/mol, XLogP of 3.27, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 8-(3-ethoxy-3-oxopropyl)-2,4-dihydro-1,3-benzoxazine-3-carboxylate is sourced from PubChem (CID 170016206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).