C22H30N2O4 — CID 88854575
tert-butyl 4-[2-(3-ethoxy-3-oxopropyl)phenyl]-4-isocyanopiperidine-1-carboxylate (PubChem CID 88854575) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-ethoxy-3-oxopropyl)phenyl]-4-isocyanopiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-ethoxy-3-oxopropyl)phenyl]-4-isocyanopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 88854575 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | tert-butyl 4-[2-(3-ethoxy-3-oxopropyl)phenyl]-4-isocyanopiperidine-1-carboxylate |
| SMILES | [C-]#[N+]C1(c2ccccc2CCC(=O)OCC)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H30N2O4/c1-6-27-19(25)12-11-17-9-7-8-10-18(17)22(23-5)13-15-24(16-14-22)20(26)28-21(2,3)4/h7-10H,6,11-16H2,1-4H3 |
| InChIKey | CRBATZSKXXBMLR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 60.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|