C22H33NO5 — CID 71849914
tert-butyl 4-hydroxy-4-[2-(3-methylbutanoyloxymethyl)phenyl]piperidine-1-carboxylate (PubChem CID 71849914) has the molecular formula C22H33NO5 and a molecular weight of 391.51 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[2-(3-methylbutanoyloxymethyl)phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-[2-(3-methylbutanoyloxymethyl)phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71849914 |
| Molecular Formula | C22H33NO5 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[2-(3-methylbutanoyloxymethyl)phenyl]piperidine-1-carboxylate |
| SMILES | CC(C)CC(=O)OCc1ccccc1C1(O)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C22H33NO5/c1-16(2)14-19(24)27-15-17-8-6-7-9-18(17)22(26)10-12-23(13-11-22)20(25)28-21(3,4)5/h6-9,16,26H,10-15H2,1-5H3 |
| InChIKey | GPHPLYQLAUXEFT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |