C22H26FNO3S — CID 68683892
tert-butyl 4-(5-fluoro-2-phenylsulfanylphenyl)-4-hydroxypiperidine-1-carboxylate (PubChem CID 68683892) has the molecular formula C22H26FNO3S and a molecular weight of 403.52 g/mol. Its IUPAC name is tert-butyl 4-(5-fluoro-2-phenylsulfanylphenyl)-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(5-fluoro-2-phenylsulfanylphenyl)-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 68683892 |
| Molecular Formula | C22H26FNO3S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | tert-butyl 4-(5-fluoro-2-phenylsulfanylphenyl)-4-hydroxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(c2cc(F)ccc2Sc2ccccc2)CC1 |
| InChI | InChI=1S/C22H26FNO3S/c1-21(2,3)27-20(25)24-13-11-22(26,12-14-24)18-15-16(23)9-10-19(18)28-17-7-5-4-6-8-17/h4-10,15,26H,11-14H2,1-3H3 |
| InChIKey | IXYZVYCVVAUCGU-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |