C18H24F3NO4 — CID 90061321
tert-butyl 4-hydroxy-4-[2-(trifluoromethoxy)phenyl]azepane-1-carboxylate (PubChem CID 90061321) has the molecular formula C18H24F3NO4 and a molecular weight of 375.39 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-4-[2-(trifluoromethoxy)phenyl]azepane-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-4-[2-(trifluoromethoxy)phenyl]azepane-1-carboxylate |
|---|---|
| PubChem CID | 90061321 |
| Molecular Formula | C18H24F3NO4 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | tert-butyl 4-hydroxy-4-[2-(trifluoromethoxy)phenyl]azepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(O)(c2ccccc2OC(F)(F)F)CC1 |
| InChI | InChI=1S/C18H24F3NO4/c1-16(2,3)26-15(23)22-11-6-9-17(24,10-12-22)13-7-4-5-8-14(13)25-18(19,20)21/h4-5,7-8,24H,6,9-12H2,1-3H3 |
| InChIKey | RLKMYSLIHZNKSP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |