C19H28FNO2 — CID 123459614
tert-butyl 4-ethyl-4-(2-fluorophenyl)azepane-1-carboxylate (PubChem CID 123459614) has the molecular formula C19H28FNO2 and a molecular weight of 321.44 g/mol. Its IUPAC name is tert-butyl 4-ethyl-4-(2-fluorophenyl)azepane-1-carboxylate.
| Compound Name | tert-butyl 4-ethyl-4-(2-fluorophenyl)azepane-1-carboxylate |
|---|---|
| PubChem CID | 123459614 |
| Molecular Formula | C19H28FNO2 |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | tert-butyl 4-ethyl-4-(2-fluorophenyl)azepane-1-carboxylate |
| SMILES | CCC1(c2ccccc2F)CCCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H28FNO2/c1-5-19(15-9-6-7-10-16(15)20)11-8-13-21(14-12-19)17(22)23-18(2,3)4/h6-7,9-10H,5,8,11-14H2,1-4H3 |
| InChIKey | ISLYEELUYHBVTJ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |