C18H26FNO3 — CID 18794739
tert-butyl 4-[(2-fluorophenyl)methyl]-4-methoxypiperidine-1-carboxylate (PubChem CID 18794739) has the molecular formula C18H26FNO3 and a molecular weight of 323.41 g/mol. Its IUPAC name is tert-butyl 4-[(2-fluorophenyl)methyl]-4-methoxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(2-fluorophenyl)methyl]-4-methoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 18794739 |
| Molecular Formula | C18H26FNO3 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | tert-butyl 4-[(2-fluorophenyl)methyl]-4-methoxypiperidine-1-carboxylate |
| SMILES | COC1(Cc2ccccc2F)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C18H26FNO3/c1-17(2,3)23-16(21)20-11-9-18(22-4,10-12-20)13-14-7-5-6-8-15(14)19/h5-8H,9-13H2,1-4H3 |
| InChIKey | SNTDWZWKOHJCPA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |